About 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine
1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine (PubChem CID 84743555) has the molecular formula C11H15BrN4
and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine.
Molecular Properties
| Compound Name | 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine |
| PubChem CID | 84743555 |
| Molecular Formula | C11H15BrN4 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine |
| SMILES | CNCc1nc(Br)c2cc(N(C)C)ccn12 |
| InChI | InChI=1S/C11H15BrN4/c1-13-7-10-14-11(12)9-6-8(15(2)3)4-5-16(9)10/h4-6,13H,7H2,1-3H3 |
| InChIKey | BLNWYNPJDUIYQF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine?
The IUPAC name of 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine (CID 84743555) is 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine.
What is the SMILES notation for 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine?
The canonical SMILES for 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine is CNCc1nc(Br)c2cc(N(C)C)ccn12.
What is the InChIKey of 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine?
The InChIKey is BLNWYNPJDUIYQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN4/c1-13-7-10-14-11(12)9-6-8(15(2)3)4-5-16(9)10/h4-6,13H,7H2,1-3H3.
What are the key properties of 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine?
1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine has a molecular weight of 283.17 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N,N-dimethyl-3-(methylaminomethyl)imidazo[1,5-a]pyridin-7-amine is sourced from PubChem (CID 84743555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).