About 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine
1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine (PubChem CID 84744883) has the molecular formula C16H16BrN3
and a molecular weight of 330.23 g/mol. Its IUPAC name is 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine.
Molecular Properties
| Compound Name | 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine |
| PubChem CID | 84744883 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine |
| SMILES | Cc1ccccc1-c1nc(Br)c2ccc(N(C)C)cn12 |
| InChI | InChI=1S/C16H16BrN3/c1-11-6-4-5-7-13(11)16-18-15(17)14-9-8-12(19(2)3)10-20(14)16/h4-10H,1-3H3 |
| InChIKey | IDCZWTDGWBESJA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine?
The IUPAC name of 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine (CID 84744883) is 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine.
What is the SMILES notation for 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine?
The canonical SMILES for 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine is Cc1ccccc1-c1nc(Br)c2ccc(N(C)C)cn12.
What is the InChIKey of 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine?
The InChIKey is IDCZWTDGWBESJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrN3/c1-11-6-4-5-7-13(11)16-18-15(17)14-9-8-12(19(2)3)10-20(14)16/h4-10H,1-3H3.
What are the key properties of 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine?
1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine has a molecular weight of 330.23 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N,N-dimethyl-3-(2-methylphenyl)imidazo[1,5-a]pyridin-6-amine is sourced from PubChem (CID 84744883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).