C18H32N2O — CID 84746234
N-[[3-methoxy-4-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-1-amine (PubChem CID 84746234) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is N-[[3-methoxy-4-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-1-amine.
| Compound Name | N-[[3-methoxy-4-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 84746234 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-[[3-methoxy-4-[(2-methylpropylamino)methyl]phenyl]methyl]-N-methylbutan-1-amine |
| SMILES | CCCCN(C)Cc1ccc(CNCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H32N2O/c1-6-7-10-20(4)14-16-8-9-17(18(11-16)21-5)13-19-12-15(2)3/h8-9,11,15,19H,6-7,10,12-14H2,1-5H3 |
| InChIKey | AKNMCKBXYUUKNS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |