C16H17NO3 — CID 84746836
2-(3-hydroxyphenyl)-2-[(4-methylphenyl)methylamino]acetic acid (PubChem CID 84746836) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-2-[(4-methylphenyl)methylamino]acetic acid.
| Compound Name | 2-(3-hydroxyphenyl)-2-[(4-methylphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 84746836 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-(3-hydroxyphenyl)-2-[(4-methylphenyl)methylamino]acetic acid |
| SMILES | Cc1ccc(CNC(C(=O)O)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C16H17NO3/c1-11-5-7-12(8-6-11)10-17-15(16(19)20)13-3-2-4-14(18)9-13/h2-9,15,17-18H,10H2,1H3,(H,19,20) |
| InChIKey | MNVXSYJTQRNYGZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |