C10H14N2O4 — CID 84748122
3-[[carboxy(1H-pyrrol-2-yl)methyl]-methylamino]propanoic acid (PubChem CID 84748122) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 3-[[carboxy(1H-pyrrol-2-yl)methyl]-methylamino]propanoic acid.
| Compound Name | 3-[[carboxy(1H-pyrrol-2-yl)methyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 84748122 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-[[carboxy(1H-pyrrol-2-yl)methyl]-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(C(=O)O)c1ccc[nH]1 |
| InChI | InChI=1S/C10H14N2O4/c1-12(6-4-8(13)14)9(10(15)16)7-3-2-5-11-7/h2-3,5,9,11H,4,6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | JVPBKQBNUNTRLN-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |