C19H30N2O — CID 84749223
2-ethoxy-4-[(2-methylpropylamino)methyl]-N,N-bis(prop-2-enyl)aniline (PubChem CID 84749223) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is 2-ethoxy-4-[(2-methylpropylamino)methyl]-N,N-bis(prop-2-enyl)aniline.
| Compound Name | 2-ethoxy-4-[(2-methylpropylamino)methyl]-N,N-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 84749223 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | 2-ethoxy-4-[(2-methylpropylamino)methyl]-N,N-bis(prop-2-enyl)aniline |
| SMILES | C=CCN(CC=C)c1ccc(CNCC(C)C)cc1OCC |
| InChI | InChI=1S/C19H30N2O/c1-6-11-21(12-7-2)18-10-9-17(13-19(18)22-8-3)15-20-14-16(4)5/h6-7,9-10,13,16,20H,1-2,8,11-12,14-15H2,3-5H3 |
| InChIKey | AZHQXTWCOIHDTM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|