About 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine
1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine (PubChem CID 84750512) has the molecular formula C11H14N4O2S2
and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine.
Molecular Properties
| Compound Name | 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine |
| PubChem CID | 84750512 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine |
| SMILES | CN(C)C(c1ccc([N+](=O)[O-])s1)c1nc(CN)cs1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-14(2)10(11-13-7(5-12)6-18-11)8-3-4-9(19-8)15(16)17/h3-4,6,10H,5,12H2,1-2H3 |
| InChIKey | KDDLLRGQLJVMHS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine?
The IUPAC name of 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine (CID 84750512) is 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine.
What is the SMILES notation for 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine?
The canonical SMILES for 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine is CN(C)C(c1ccc([N+](=O)[O-])s1)c1nc(CN)cs1.
What is the InChIKey of 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine?
The InChIKey is KDDLLRGQLJVMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S2/c1-14(2)10(11-13-7(5-12)6-18-11)8-3-4-9(19-8)15(16)17/h3-4,6,10H,5,12H2,1-2H3.
What are the key properties of 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine?
1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine has a molecular weight of 298.39 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(aminomethyl)-1,3-thiazol-2-yl]-N,N-dimethyl-1-(5-nitrothiophen-2-yl)methanamine is sourced from PubChem (CID 84750512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).