C16H14ClFO3 — CID 84752972
3-(4-chloro-2-fluorophenyl)-2-(4-methoxyphenyl)propanoic acid (PubChem CID 84752972) has the molecular formula C16H14ClFO3 and a molecular weight of 308.74 g/mol. Its IUPAC name is 3-(4-chloro-2-fluorophenyl)-2-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-(4-chloro-2-fluorophenyl)-2-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 84752972 |
| Molecular Formula | C16H14ClFO3 |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 3-(4-chloro-2-fluorophenyl)-2-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C(Cc2ccc(Cl)cc2F)C(=O)O)cc1 |
| InChI | InChI=1S/C16H14ClFO3/c1-21-13-6-3-10(4-7-13)14(16(19)20)8-11-2-5-12(17)9-15(11)18/h2-7,9,14H,8H2,1H3,(H,19,20) |
| InChIKey | IGMIUERIIKQHPD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |