C17H26FN3 — CID 84753207
N'-[5-[[bis(prop-2-enyl)amino]methyl]-2-fluorophenyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 84753207) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is N'-[5-[[bis(prop-2-enyl)amino]methyl]-2-fluorophenyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[5-[[bis(prop-2-enyl)amino]methyl]-2-fluorophenyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 84753207 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | N'-[5-[[bis(prop-2-enyl)amino]methyl]-2-fluorophenyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=CCN(CC=C)Cc1ccc(F)c(N(C)CCNC)c1 |
| InChI | InChI=1S/C17H26FN3/c1-5-10-21(11-6-2)14-15-7-8-16(18)17(13-15)20(4)12-9-19-3/h5-8,13,19H,1-2,9-12,14H2,3-4H3 |
| InChIKey | PBELQOWDZPAQJL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|