C17H28FN3O — CID 84753551
N-[[3-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 84753551) has the molecular formula C17H28FN3O and a molecular weight of 309.43 g/mol. Its IUPAC name is N-[[3-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[3-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 84753551 |
| Molecular Formula | C17H28FN3O |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | N-[[3-(2,6-dimethylmorpholin-4-yl)-4-fluorophenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC1CN(c2cc(CNCCN(C)C)ccc2F)CC(C)O1 |
| InChI | InChI=1S/C17H28FN3O/c1-13-11-21(12-14(2)22-13)17-9-15(5-6-16(17)18)10-19-7-8-20(3)4/h5-6,9,13-14,19H,7-8,10-12H2,1-4H3 |
| InChIKey | OTILQBULTUEARM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|