C18H29N3O2 — CID 84754118
4-[(3-methoxy-4-piperazin-1-ylphenyl)methyl]-2,6-dimethylmorpholine (PubChem CID 84754118) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-[(3-methoxy-4-piperazin-1-ylphenyl)methyl]-2,6-dimethylmorpholine.
| Compound Name | 4-[(3-methoxy-4-piperazin-1-ylphenyl)methyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 84754118 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 4-[(3-methoxy-4-piperazin-1-ylphenyl)methyl]-2,6-dimethylmorpholine |
| SMILES | COc1cc(CN2CC(C)OC(C)C2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C18H29N3O2/c1-14-11-20(12-15(2)23-14)13-16-4-5-17(18(10-16)22-3)21-8-6-19-7-9-21/h4-5,10,14-15,19H,6-9,11-13H2,1-3H3 |
| InChIKey | FQBKCJIJEFTMTE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|