C13H22N2O2 — CID 84754903
2-[[4-(aminomethyl)-3-ethoxyphenyl]methyl-methylamino]ethanol (PubChem CID 84754903) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-[[4-(aminomethyl)-3-ethoxyphenyl]methyl-methylamino]ethanol.
| Compound Name | 2-[[4-(aminomethyl)-3-ethoxyphenyl]methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 84754903 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-[[4-(aminomethyl)-3-ethoxyphenyl]methyl-methylamino]ethanol |
| SMILES | CCOc1cc(CN(C)CCO)ccc1CN |
| InChI | InChI=1S/C13H22N2O2/c1-3-17-13-8-11(4-5-12(13)9-14)10-15(2)6-7-16/h4-5,8,16H,3,6-7,9-10,14H2,1-2H3 |
| InChIKey | MLCJJGVUWVPASO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |