C10H20N2OS — CID 84755018
2-piperidin-3-ylsulfanyl-N-propylacetamide (PubChem CID 84755018) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 2-piperidin-3-ylsulfanyl-N-propylacetamide.
| Compound Name | 2-piperidin-3-ylsulfanyl-N-propylacetamide |
|---|---|
| PubChem CID | 84755018 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-piperidin-3-ylsulfanyl-N-propylacetamide |
| SMILES | CCCNC(=O)CSC1CCCNC1 |
| InChI | InChI=1S/C10H20N2OS/c1-2-5-12-10(13)8-14-9-4-3-6-11-7-9/h9,11H,2-8H2,1H3,(H,12,13) |
| InChIKey | FISQJCCENCOGKZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |