3-piperidin-3-ylsulfonylpropanoic acid

C8H15NO4S — CID 84755096

IUPAC3-piperidin-3-ylsulfonylpropanoic acid
SMILESO=C(O)CCS(=O)(=O)C1CCCNC1
InChIInChI=1S/C8H15NO4S/c10-8(11)3-5-14(12,13)7-2-1-4-9-6-7/h7,9H,1-6H2,(H,10,11)
InChIKeySTNXTGRCDBIEFI-UHFFFAOYSA-N
MW221.28 g/mol
LogP-0.37
Rot. Bonds4

About 3-piperidin-3-ylsulfonylpropanoic acid

3-piperidin-3-ylsulfonylpropanoic acid (PubChem CID 84755096) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-piperidin-3-ylsulfonylpropanoic acid.

Molecular Properties

Compound Name3-piperidin-3-ylsulfonylpropanoic acid
PubChem CID84755096
Molecular FormulaC8H15NO4S
Molecular Weight221.28 g/mol
Exact Mass221.07
IUPAC Name3-piperidin-3-ylsulfonylpropanoic acid
SMILESO=C(O)CCS(=O)(=O)C1CCCNC1
InChIInChI=1S/C8H15NO4S/c10-8(11)3-5-14(12,13)7-2-1-4-9-6-7/h7,9H,1-6H2,(H,10,11)
InChIKeySTNXTGRCDBIEFI-UHFFFAOYSA-N
XLogP-0.37
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.28
LogP ≤ 5-0.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-piperidin-3-ylsulfonylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-piperidin-3-ylsulfonylpropanoic acid?
The IUPAC name of 3-piperidin-3-ylsulfonylpropanoic acid (CID 84755096) is 3-piperidin-3-ylsulfonylpropanoic acid.
What is the SMILES notation for 3-piperidin-3-ylsulfonylpropanoic acid?
The canonical SMILES for 3-piperidin-3-ylsulfonylpropanoic acid is O=C(O)CCS(=O)(=O)C1CCCNC1.
What is the InChIKey of 3-piperidin-3-ylsulfonylpropanoic acid?
The InChIKey is STNXTGRCDBIEFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4S/c10-8(11)3-5-14(12,13)7-2-1-4-9-6-7/h7,9H,1-6H2,(H,10,11).
What are the key properties of 3-piperidin-3-ylsulfonylpropanoic acid?
3-piperidin-3-ylsulfonylpropanoic acid has a molecular weight of 221.28 g/mol, XLogP of -0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-3-ylsulfonylpropanoic acid is sourced from PubChem (CID 84755096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).