C12H17NO5 — CID 84756125
1-(3-ethoxy-3-oxopropyl)-2-(methoxymethyl)pyrrole-3-carboxylic acid (PubChem CID 84756125) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(3-ethoxy-3-oxopropyl)-2-(methoxymethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-(3-ethoxy-3-oxopropyl)-2-(methoxymethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 84756125 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-(3-ethoxy-3-oxopropyl)-2-(methoxymethyl)pyrrole-3-carboxylic acid |
| SMILES | CCOC(=O)CCn1ccc(C(=O)O)c1COC |
| InChI | InChI=1S/C12H17NO5/c1-3-18-11(14)5-7-13-6-4-9(12(15)16)10(13)8-17-2/h4,6H,3,5,7-8H2,1-2H3,(H,15,16) |
| InChIKey | QPVQVXZNOKABBX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |