About N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine
N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine (PubChem CID 84760946) has the molecular formula C9H11ClF3N3O2S
and a molecular weight of 317.72 g/mol. Its IUPAC name is N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine |
| PubChem CID | 84760946 |
| Molecular Formula | C9H11ClF3N3O2S |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine |
| SMILES | NCCNS(=O)(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C9H11ClF3N3O2S/c10-7-2-1-6(9(11,12)13)5-8(7)16-19(17,18)15-4-3-14/h1-2,5,15-16H,3-4,14H2 |
| InChIKey | YLDGVZFYGBIPPT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine?
The IUPAC name of N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine (CID 84760946) is N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine?
The canonical SMILES for N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine is NCCNS(=O)(=O)Nc1cc(C(F)(F)F)ccc1Cl.
What is the InChIKey of N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine?
The InChIKey is YLDGVZFYGBIPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClF3N3O2S/c10-7-2-1-6(9(11,12)13)5-8(7)16-19(17,18)15-4-3-14/h1-2,5,15-16H,3-4,14H2.
What are the key properties of N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine?
N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine has a molecular weight of 317.72 g/mol, XLogP of 1.56, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[2-chloro-5-(trifluoromethyl)phenyl]sulfamoyl]ethane-1,2-diamine is sourced from PubChem (CID 84760946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).