About N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine
N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine (PubChem CID 84761041) has the molecular formula C3H9N7O2S
and a molecular weight of 207.22 g/mol. Its IUPAC name is N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine |
| PubChem CID | 84761041 |
| Molecular Formula | C3H9N7O2S |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine |
| SMILES | NCCNS(=O)(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C3H9N7O2S/c4-1-2-5-13(11,12)8-3-6-9-10-7-3/h5H,1-2,4H2,(H2,6,7,8,9,10) |
| InChIKey | DXGXDCQSGQSYKA-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine?
The IUPAC name of N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine (CID 84761041) is N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine?
The canonical SMILES for N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine is NCCNS(=O)(=O)Nc1nn[nH]n1.
What is the InChIKey of N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine?
The InChIKey is DXGXDCQSGQSYKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N7O2S/c4-1-2-5-13(11,12)8-3-6-9-10-7-3/h5H,1-2,4H2,(H2,6,7,8,9,10).
What are the key properties of N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine?
N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine has a molecular weight of 207.22 g/mol, XLogP of -2.60, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2H-tetrazol-5-ylsulfamoyl)ethane-1,2-diamine is sourced from PubChem (CID 84761041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).