About 4-(fluoromethyl)-1,3-dihydroimidazol-2-one
4-(fluoromethyl)-1,3-dihydroimidazol-2-one (PubChem CID 84762078) has the molecular formula C4H5FN2O
and a molecular weight of 116.09 g/mol. Its IUPAC name is 4-(fluoromethyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-(fluoromethyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 84762078 |
| Molecular Formula | C4H5FN2O |
| Molecular Weight | 116.09 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 4-(fluoromethyl)-1,3-dihydroimidazol-2-one |
| SMILES | O=c1[nH]cc(CF)[nH]1 |
| InChI | InChI=1S/C4H5FN2O/c5-1-3-2-6-4(8)7-3/h2H,1H2,(H2,6,7,8) |
| InChIKey | ZMXZGBOYCNVFSD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.09 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(fluoromethyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(fluoromethyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-(fluoromethyl)-1,3-dihydroimidazol-2-one (CID 84762078) is 4-(fluoromethyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-(fluoromethyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-(fluoromethyl)-1,3-dihydroimidazol-2-one is O=c1[nH]cc(CF)[nH]1.
What is the InChIKey of 4-(fluoromethyl)-1,3-dihydroimidazol-2-one?
The InChIKey is ZMXZGBOYCNVFSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FN2O/c5-1-3-2-6-4(8)7-3/h2H,1H2,(H2,6,7,8).
What are the key properties of 4-(fluoromethyl)-1,3-dihydroimidazol-2-one?
4-(fluoromethyl)-1,3-dihydroimidazol-2-one has a molecular weight of 116.09 g/mol, XLogP of 0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(fluoromethyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 84762078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).