About 2-(fluoromethyl)-1,3-oxazol-4-ol
2-(fluoromethyl)-1,3-oxazol-4-ol (PubChem CID 84762088) has the molecular formula C4H4FNO2
and a molecular weight of 117.08 g/mol. Its IUPAC name is 2-(fluoromethyl)-1,3-oxazol-4-ol.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-1,3-oxazol-4-ol |
| PubChem CID | 84762088 |
| Molecular Formula | C4H4FNO2 |
| Molecular Weight | 117.08 g/mol |
| Exact Mass | 117.02 |
| IUPAC Name | 2-(fluoromethyl)-1,3-oxazol-4-ol |
| SMILES | Oc1coc(CF)n1 |
| InChI | InChI=1S/C4H4FNO2/c5-1-4-6-3(7)2-8-4/h2,7H,1H2 |
| InChIKey | AVHPZKSFRVAJMY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.08 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(fluoromethyl)-1,3-oxazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-1,3-oxazol-4-ol?
The IUPAC name of 2-(fluoromethyl)-1,3-oxazol-4-ol (CID 84762088) is 2-(fluoromethyl)-1,3-oxazol-4-ol.
What is the SMILES notation for 2-(fluoromethyl)-1,3-oxazol-4-ol?
The canonical SMILES for 2-(fluoromethyl)-1,3-oxazol-4-ol is Oc1coc(CF)n1.
What is the InChIKey of 2-(fluoromethyl)-1,3-oxazol-4-ol?
The InChIKey is AVHPZKSFRVAJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4FNO2/c5-1-4-6-3(7)2-8-4/h2,7H,1H2.
What are the key properties of 2-(fluoromethyl)-1,3-oxazol-4-ol?
2-(fluoromethyl)-1,3-oxazol-4-ol has a molecular weight of 117.08 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-1,3-oxazol-4-ol is sourced from PubChem (CID 84762088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).