About [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine
[5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine (PubChem CID 84762287) has the molecular formula C5H7FN2O
and a molecular weight of 130.12 g/mol. Its IUPAC name is [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine |
| PubChem CID | 84762287 |
| Molecular Formula | C5H7FN2O |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine |
| SMILES | NCc1ncc(CF)o1 |
| InChI | InChI=1S/C5H7FN2O/c6-1-4-3-8-5(2-7)9-4/h3H,1-2,7H2 |
| InChIKey | FWNFVCJLCMHBGM-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine?
The IUPAC name of [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine (CID 84762287) is [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine.
What is the SMILES notation for [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine?
The canonical SMILES for [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine is NCc1ncc(CF)o1.
What is the InChIKey of [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine?
The InChIKey is FWNFVCJLCMHBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7FN2O/c6-1-4-3-8-5(2-7)9-4/h3H,1-2,7H2.
What are the key properties of [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine?
[5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine has a molecular weight of 130.12 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(fluoromethyl)-1,3-oxazol-2-yl]methanamine is sourced from PubChem (CID 84762287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).