About 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine
2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine (PubChem CID 84762826) has the molecular formula C6H9FN2O
and a molecular weight of 144.15 g/mol. Its IUPAC name is 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine |
| PubChem CID | 84762826 |
| Molecular Formula | C6H9FN2O |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine |
| SMILES | NCCc1coc(CF)n1 |
| InChI | InChI=1S/C6H9FN2O/c7-3-6-9-5(1-2-8)4-10-6/h4H,1-3,8H2 |
| InChIKey | WBLZHZASAPACEL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine?
The IUPAC name of 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine (CID 84762826) is 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine.
What is the SMILES notation for 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine?
The canonical SMILES for 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine is NCCc1coc(CF)n1.
What is the InChIKey of 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine?
The InChIKey is WBLZHZASAPACEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9FN2O/c7-3-6-9-5(1-2-8)4-10-6/h4H,1-3,8H2.
What are the key properties of 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine?
2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine has a molecular weight of 144.15 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(fluoromethyl)-1,3-oxazol-4-yl]ethanamine is sourced from PubChem (CID 84762826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).