About 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde
2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde (PubChem CID 84762976) has the molecular formula C5H3F2NO2
and a molecular weight of 147.08 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 84762976 |
| Molecular Formula | C5H3F2NO2 |
| Molecular Weight | 147.08 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1coc(C(F)F)n1 |
| InChI | InChI=1S/C5H3F2NO2/c6-4(7)5-8-3(1-9)2-10-5/h1-2,4H |
| InChIKey | CBFCCJOICQIVPV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.08 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde (CID 84762976) is 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde is O=Cc1coc(C(F)F)n1.
What is the InChIKey of 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde?
The InChIKey is CBFCCJOICQIVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F2NO2/c6-4(7)5-8-3(1-9)2-10-5/h1-2,4H.
What are the key properties of 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde?
2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde has a molecular weight of 147.08 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 84762976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).