About 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one
4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one (PubChem CID 84763043) has the molecular formula C5H6F2N2O
and a molecular weight of 148.11 g/mol. Its IUPAC name is 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 84763043 |
| Molecular Formula | C5H6F2N2O |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one |
| SMILES | CC(F)(F)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H6F2N2O/c1-5(6,7)3-2-8-4(10)9-3/h2H,1H3,(H2,8,9,10) |
| InChIKey | UUFIAKXDQYMPIH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one (CID 84763043) is 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one is CC(F)(F)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one?
The InChIKey is UUFIAKXDQYMPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2N2O/c1-5(6,7)3-2-8-4(10)9-3/h2H,1H3,(H2,8,9,10).
What are the key properties of 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one?
4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one has a molecular weight of 148.11 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-difluoroethyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 84763043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).