About 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine
1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine (PubChem CID 84763346) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine |
| PubChem CID | 84763346 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine |
| SMILES | CN1CCC=C(C2(N)CC2)C1 |
| InChI | InChI=1S/C9H16N2/c1-11-6-2-3-8(7-11)9(10)4-5-9/h3H,2,4-7,10H2,1H3 |
| InChIKey | ZDUCKJQJPVAZNC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine?
The IUPAC name of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine (CID 84763346) is 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine.
What is the SMILES notation for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine?
The canonical SMILES for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine is CN1CCC=C(C2(N)CC2)C1.
What is the InChIKey of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine?
The InChIKey is ZDUCKJQJPVAZNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-11-6-2-3-8(7-11)9(10)4-5-9/h3H,2,4-7,10H2,1H3.
What are the key properties of 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine?
1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine has a molecular weight of 152.24 g/mol, XLogP of 0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)cyclopropan-1-amine is sourced from PubChem (CID 84763346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).