About 2-fluoro-3,6-dihydroxybenzaldehyde
2-fluoro-3,6-dihydroxybenzaldehyde (PubChem CID 84763685) has the molecular formula C7H5FO3
and a molecular weight of 156.11 g/mol. Its IUPAC name is 2-fluoro-3,6-dihydroxybenzaldehyde.
Molecular Properties
| Compound Name | 2-fluoro-3,6-dihydroxybenzaldehyde |
| PubChem CID | 84763685 |
| Molecular Formula | C7H5FO3 |
| Molecular Weight | 156.11 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | 2-fluoro-3,6-dihydroxybenzaldehyde |
| SMILES | O=Cc1c(O)ccc(O)c1F |
| InChI | InChI=1S/C7H5FO3/c8-7-4(3-9)5(10)1-2-6(7)11/h1-3,10-11H |
| InChIKey | LXAASBOARREOKB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3,6-dihydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,6-dihydroxybenzaldehyde?
The IUPAC name of 2-fluoro-3,6-dihydroxybenzaldehyde (CID 84763685) is 2-fluoro-3,6-dihydroxybenzaldehyde.
What is the SMILES notation for 2-fluoro-3,6-dihydroxybenzaldehyde?
The canonical SMILES for 2-fluoro-3,6-dihydroxybenzaldehyde is O=Cc1c(O)ccc(O)c1F.
What is the InChIKey of 2-fluoro-3,6-dihydroxybenzaldehyde?
The InChIKey is LXAASBOARREOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FO3/c8-7-4(3-9)5(10)1-2-6(7)11/h1-3,10-11H.
What are the key properties of 2-fluoro-3,6-dihydroxybenzaldehyde?
2-fluoro-3,6-dihydroxybenzaldehyde has a molecular weight of 156.11 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,6-dihydroxybenzaldehyde is sourced from PubChem (CID 84763685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).