About 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol
1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol (PubChem CID 84763802) has the molecular formula C7H8FNO2
and a molecular weight of 157.14 g/mol. Its IUPAC name is 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol.
Molecular Properties
| Compound Name | 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol |
| PubChem CID | 84763802 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol |
| SMILES | OC1(c2coc(CF)n2)CC1 |
| InChI | InChI=1S/C7H8FNO2/c8-3-6-9-5(4-11-6)7(10)1-2-7/h4,10H,1-3H2 |
| InChIKey | WHJWJKJHTVHNPW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol?
The IUPAC name of 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol (CID 84763802) is 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol.
What is the SMILES notation for 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol?
The canonical SMILES for 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol is OC1(c2coc(CF)n2)CC1.
What is the InChIKey of 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol?
The InChIKey is WHJWJKJHTVHNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO2/c8-3-6-9-5(4-11-6)7(10)1-2-7/h4,10H,1-3H2.
What are the key properties of 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol?
1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol has a molecular weight of 157.14 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(fluoromethyl)-1,3-oxazol-4-yl]cyclopropan-1-ol is sourced from PubChem (CID 84763802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).