C6H9FN2S — CID 84764241
1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 84764241) has the molecular formula C6H9FN2S and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 84764241 |
| Molecular Formula | C6H9FN2S |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 1-[5-(fluoromethyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | CC(N)c1ncc(CF)s1 |
| InChI | InChI=1S/C6H9FN2S/c1-4(8)6-9-3-5(2-7)10-6/h3-4H,2,8H2,1H3 |
| InChIKey | SQTWTGUJXLNZOE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |