About 2-chloro-4-ethyl-1,3-thiazol-5-amine
2-chloro-4-ethyl-1,3-thiazol-5-amine (PubChem CID 84764549) has the molecular formula C5H7ClN2S
and a molecular weight of 162.65 g/mol. Its IUPAC name is 2-chloro-4-ethyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | 2-chloro-4-ethyl-1,3-thiazol-5-amine |
| PubChem CID | 84764549 |
| Molecular Formula | C5H7ClN2S |
| Molecular Weight | 162.65 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 2-chloro-4-ethyl-1,3-thiazol-5-amine |
| SMILES | CCc1nc(Cl)sc1N |
| InChI | InChI=1S/C5H7ClN2S/c1-2-3-4(7)9-5(6)8-3/h2,7H2,1H3 |
| InChIKey | ULKVFXLKHDBOFG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.65 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-ethyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-ethyl-1,3-thiazol-5-amine?
The IUPAC name of 2-chloro-4-ethyl-1,3-thiazol-5-amine (CID 84764549) is 2-chloro-4-ethyl-1,3-thiazol-5-amine.
What is the SMILES notation for 2-chloro-4-ethyl-1,3-thiazol-5-amine?
The canonical SMILES for 2-chloro-4-ethyl-1,3-thiazol-5-amine is CCc1nc(Cl)sc1N.
What is the InChIKey of 2-chloro-4-ethyl-1,3-thiazol-5-amine?
The InChIKey is ULKVFXLKHDBOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2S/c1-2-3-4(7)9-5(6)8-3/h2,7H2,1H3.
What are the key properties of 2-chloro-4-ethyl-1,3-thiazol-5-amine?
2-chloro-4-ethyl-1,3-thiazol-5-amine has a molecular weight of 162.65 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-ethyl-1,3-thiazol-5-amine is sourced from PubChem (CID 84764549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).