About [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine
[2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine (PubChem CID 84764773) has the molecular formula C5H6F2N2S
and a molecular weight of 164.18 g/mol. Its IUPAC name is [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 84764773 |
| Molecular Formula | C5H6F2N2S |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1cnc(C(F)F)s1 |
| InChI | InChI=1S/C5H6F2N2S/c6-4(7)5-9-2-3(1-8)10-5/h2,4H,1,8H2 |
| InChIKey | VDHMXMCQEZVJFM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine (CID 84764773) is [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine is NCc1cnc(C(F)F)s1.
What is the InChIKey of [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is VDHMXMCQEZVJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F2N2S/c6-4(7)5-9-2-3(1-8)10-5/h2,4H,1,8H2.
What are the key properties of [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine?
[2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 164.18 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(difluoromethyl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 84764773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).