C10H11FO — CID 84765074
1-(2-fluoro-3,6-dimethylphenyl)ethanone (PubChem CID 84765074) has the molecular formula C10H11FO and a molecular weight of 166.19 g/mol. Its IUPAC name is 1-(2-fluoro-3,6-dimethylphenyl)ethanone.
| Compound Name | 1-(2-fluoro-3,6-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 84765074 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 1-(2-fluoro-3,6-dimethylphenyl)ethanone |
| SMILES | CC(=O)c1c(C)ccc(C)c1F |
| InChI | InChI=1S/C10H11FO/c1-6-4-5-7(2)10(11)9(6)8(3)12/h4-5H,1-3H3 |
| InChIKey | GZXWHCRZKJXRJP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |