About 2-(4,4-difluorothiolan-3-yl)ethanamine
2-(4,4-difluorothiolan-3-yl)ethanamine (PubChem CID 84765255) has the molecular formula C6H11F2NS
and a molecular weight of 167.22 g/mol. Its IUPAC name is 2-(4,4-difluorothiolan-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,4-difluorothiolan-3-yl)ethanamine |
| PubChem CID | 84765255 |
| Molecular Formula | C6H11F2NS |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-(4,4-difluorothiolan-3-yl)ethanamine |
| SMILES | NCCC1CSCC1(F)F |
| InChI | InChI=1S/C6H11F2NS/c7-6(8)4-10-3-5(6)1-2-9/h5H,1-4,9H2 |
| InChIKey | XKNVXJWHORHNAG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-difluorothiolan-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorothiolan-3-yl)ethanamine?
The IUPAC name of 2-(4,4-difluorothiolan-3-yl)ethanamine (CID 84765255) is 2-(4,4-difluorothiolan-3-yl)ethanamine.
What is the SMILES notation for 2-(4,4-difluorothiolan-3-yl)ethanamine?
The canonical SMILES for 2-(4,4-difluorothiolan-3-yl)ethanamine is NCCC1CSCC1(F)F.
What is the InChIKey of 2-(4,4-difluorothiolan-3-yl)ethanamine?
The InChIKey is XKNVXJWHORHNAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NS/c7-6(8)4-10-3-5(6)1-2-9/h5H,1-4,9H2.
What are the key properties of 2-(4,4-difluorothiolan-3-yl)ethanamine?
2-(4,4-difluorothiolan-3-yl)ethanamine has a molecular weight of 167.22 g/mol, XLogP of 1.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorothiolan-3-yl)ethanamine is sourced from PubChem (CID 84765255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).