About 3-oxa-1,9-diazaspiro[4.6]undecan-2-one
3-oxa-1,9-diazaspiro[4.6]undecan-2-one (PubChem CID 84765780) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-oxa-1,9-diazaspiro[4.6]undecan-2-one.
Molecular Properties
| Compound Name | 3-oxa-1,9-diazaspiro[4.6]undecan-2-one |
| PubChem CID | 84765780 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-oxa-1,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1NC2(CCCNCC2)CO1 |
| InChI | InChI=1S/C8H14N2O2/c11-7-10-8(6-12-7)2-1-4-9-5-3-8/h9H,1-6H2,(H,10,11) |
| InChIKey | BCUDIJOQNMYXPO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxa-1,9-diazaspiro[4.6]undecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxa-1,9-diazaspiro[4.6]undecan-2-one?
The IUPAC name of 3-oxa-1,9-diazaspiro[4.6]undecan-2-one (CID 84765780) is 3-oxa-1,9-diazaspiro[4.6]undecan-2-one.
What is the SMILES notation for 3-oxa-1,9-diazaspiro[4.6]undecan-2-one?
The canonical SMILES for 3-oxa-1,9-diazaspiro[4.6]undecan-2-one is O=C1NC2(CCCNCC2)CO1.
What is the InChIKey of 3-oxa-1,9-diazaspiro[4.6]undecan-2-one?
The InChIKey is BCUDIJOQNMYXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c11-7-10-8(6-12-7)2-1-4-9-5-3-8/h9H,1-6H2,(H,10,11).
What are the key properties of 3-oxa-1,9-diazaspiro[4.6]undecan-2-one?
3-oxa-1,9-diazaspiro[4.6]undecan-2-one has a molecular weight of 170.21 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxa-1,9-diazaspiro[4.6]undecan-2-one is sourced from PubChem (CID 84765780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).