About 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one
3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one (PubChem CID 84766736) has the molecular formula C7H14N2OS
and a molecular weight of 174.27 g/mol. Its IUPAC name is 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one |
| PubChem CID | 84766736 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one |
| SMILES | CN1C(=O)CCSCC1CN |
| InChI | InChI=1S/C7H14N2OS/c1-9-6(4-8)5-11-3-2-7(9)10/h6H,2-5,8H2,1H3 |
| InChIKey | KRXSSBDZFXWNSB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one?
The IUPAC name of 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one (CID 84766736) is 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one.
What is the SMILES notation for 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one?
The canonical SMILES for 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one is CN1C(=O)CCSCC1CN.
What is the InChIKey of 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one?
The InChIKey is KRXSSBDZFXWNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2OS/c1-9-6(4-8)5-11-3-2-7(9)10/h6H,2-5,8H2,1H3.
What are the key properties of 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one?
3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one has a molecular weight of 174.27 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4-methyl-1,4-thiazepan-5-one is sourced from PubChem (CID 84766736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).