C6H10ClN3O — CID 84767030
N-[(5-chloro-1-ethylpyrazol-4-yl)methyl]hydroxylamine (PubChem CID 84767030) has the molecular formula C6H10ClN3O and a molecular weight of 175.62 g/mol. Its IUPAC name is N-[(5-chloro-1-ethylpyrazol-4-yl)methyl]hydroxylamine.
| Compound Name | N-[(5-chloro-1-ethylpyrazol-4-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 84767030 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | N-[(5-chloro-1-ethylpyrazol-4-yl)methyl]hydroxylamine |
| SMILES | CCn1ncc(CNO)c1Cl |
| InChI | InChI=1S/C6H10ClN3O/c1-2-10-6(7)5(3-8-10)4-9-11/h3,9,11H,2,4H2,1H3 |
| InChIKey | RUFYEUNCMCGKSW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|