About 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine
1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine (PubChem CID 84767066) has the molecular formula C7H10F2N2O
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine.
Molecular Properties
| Compound Name | 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine |
| PubChem CID | 84767066 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine |
| SMILES | CNC(C)c1ncc(C(F)F)o1 |
| InChI | InChI=1S/C7H10F2N2O/c1-4(10-2)7-11-3-5(12-7)6(8)9/h3-4,6,10H,1-2H3 |
| InChIKey | FTVGCECHHPFGPR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine?
The IUPAC name of 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine (CID 84767066) is 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine.
What is the SMILES notation for 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine?
The canonical SMILES for 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine is CNC(C)c1ncc(C(F)F)o1.
What is the InChIKey of 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine?
The InChIKey is FTVGCECHHPFGPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2N2O/c1-4(10-2)7-11-3-5(12-7)6(8)9/h3-4,6,10H,1-2H3.
What are the key properties of 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine?
1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine has a molecular weight of 176.17 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(difluoromethyl)-1,3-oxazol-2-yl]-N-methylethanamine is sourced from PubChem (CID 84767066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).