About 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone
2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone (PubChem CID 84767265) has the molecular formula C7H7N5O
and a molecular weight of 177.17 g/mol. Its IUPAC name is 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
| PubChem CID | 84767265 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone |
| SMILES | NCC(=O)c1cnc2ncnn2c1 |
| InChI | InChI=1S/C7H7N5O/c8-1-6(13)5-2-9-7-10-4-11-12(7)3-5/h2-4H,1,8H2 |
| InChIKey | ZTNIRNGJGNCRDB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone?
The IUPAC name of 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone (CID 84767265) is 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone.
What is the SMILES notation for 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone?
The canonical SMILES for 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone is NCC(=O)c1cnc2ncnn2c1.
What is the InChIKey of 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone?
The InChIKey is ZTNIRNGJGNCRDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O/c8-1-6(13)5-2-9-7-10-4-11-12(7)3-5/h2-4H,1,8H2.
What are the key properties of 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone?
2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone has a molecular weight of 177.17 g/mol, XLogP of -0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)ethanone is sourced from PubChem (CID 84767265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).