C7H13F2NS — CID 84768505
2-(3,3-difluorothian-4-yl)ethanamine (PubChem CID 84768505) has the molecular formula C7H13F2NS and a molecular weight of 181.25 g/mol. Its IUPAC name is 2-(3,3-difluorothian-4-yl)ethanamine.
| Compound Name | 2-(3,3-difluorothian-4-yl)ethanamine |
|---|---|
| PubChem CID | 84768505 |
| Molecular Formula | C7H13F2NS |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(3,3-difluorothian-4-yl)ethanamine |
| SMILES | NCCC1CCSCC1(F)F |
| InChI | InChI=1S/C7H13F2NS/c8-7(9)5-11-4-2-6(7)1-3-10/h6H,1-5,10H2 |
| InChIKey | VONLVHZGMYSNNF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |