5-amino-3-fluoro-2,4-dimethylbenzoic acid

C9H10FNO2 — CID 84768923

IUPAC5-amino-3-fluoro-2,4-dimethylbenzoic acid
SMILESCc1c(N)cc(C(=O)O)c(C)c1F
InChIInChI=1S/C9H10FNO2/c1-4-6(9(12)13)3-7(11)5(2)8(4)10/h3H,11H2,1-2H3,(H,12,13)
InChIKeyGOYBLGSMRKDWLF-UHFFFAOYSA-N
MW183.18 g/mol
LogP1.72
Rot. Bonds1

About 5-amino-3-fluoro-2,4-dimethylbenzoic acid

5-amino-3-fluoro-2,4-dimethylbenzoic acid (PubChem CID 84768923) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is 5-amino-3-fluoro-2,4-dimethylbenzoic acid.

Molecular Properties

Compound Name5-amino-3-fluoro-2,4-dimethylbenzoic acid
PubChem CID84768923
Molecular FormulaC9H10FNO2
Molecular Weight183.18 g/mol
Exact Mass183.07
IUPAC Name5-amino-3-fluoro-2,4-dimethylbenzoic acid
SMILESCc1c(N)cc(C(=O)O)c(C)c1F
InChIInChI=1S/C9H10FNO2/c1-4-6(9(12)13)3-7(11)5(2)8(4)10/h3H,11H2,1-2H3,(H,12,13)
InChIKeyGOYBLGSMRKDWLF-UHFFFAOYSA-N
XLogP1.72
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.18
LogP ≤ 51.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 5-amino-3-fluoro-2,4-dimethylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-3-fluoro-2,4-dimethylbenzoic acid?
The IUPAC name of 5-amino-3-fluoro-2,4-dimethylbenzoic acid (CID 84768923) is 5-amino-3-fluoro-2,4-dimethylbenzoic acid.
What is the SMILES notation for 5-amino-3-fluoro-2,4-dimethylbenzoic acid?
The canonical SMILES for 5-amino-3-fluoro-2,4-dimethylbenzoic acid is Cc1c(N)cc(C(=O)O)c(C)c1F.
What is the InChIKey of 5-amino-3-fluoro-2,4-dimethylbenzoic acid?
The InChIKey is GOYBLGSMRKDWLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c1-4-6(9(12)13)3-7(11)5(2)8(4)10/h3H,11H2,1-2H3,(H,12,13).
What are the key properties of 5-amino-3-fluoro-2,4-dimethylbenzoic acid?
5-amino-3-fluoro-2,4-dimethylbenzoic acid has a molecular weight of 183.18 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-fluoro-2,4-dimethylbenzoic acid is sourced from PubChem (CID 84768923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).