About 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine
1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine (PubChem CID 84768959) has the molecular formula C10H11F2N
and a molecular weight of 183.20 g/mol. Its IUPAC name is 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine |
| PubChem CID | 84768959 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine |
| SMILES | Cc1cc(F)c(F)cc1C1(N)CC1 |
| InChI | InChI=1S/C10H11F2N/c1-6-4-8(11)9(12)5-7(6)10(13)2-3-10/h4-5H,2-3,13H2,1H3 |
| InChIKey | PEJRCJXEBVLIAA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine?
The IUPAC name of 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine (CID 84768959) is 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine.
What is the SMILES notation for 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine?
The canonical SMILES for 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine is Cc1cc(F)c(F)cc1C1(N)CC1.
What is the InChIKey of 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine?
The InChIKey is PEJRCJXEBVLIAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N/c1-6-4-8(11)9(12)5-7(6)10(13)2-3-10/h4-5H,2-3,13H2,1H3.
What are the key properties of 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine?
1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine has a molecular weight of 183.20 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-difluoro-2-methylphenyl)cyclopropan-1-amine is sourced from PubChem (CID 84768959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).