About 3-sulfobenzoic acid
3-sulfobenzoic acid (PubChem CID 8477) has the molecular formula C7H6O5S
and a molecular weight of 202.19 g/mol. Its IUPAC name is 3-sulfobenzoic acid.
Molecular Properties
| Compound Name | 3-sulfobenzoic acid |
| PubChem CID | 8477 |
| Molecular Formula | C7H6O5S |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | 3-sulfobenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C7H6O5S/c8-7(9)5-2-1-3-6(4-5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12) |
| InChIKey | QMWGSOMVXSRXQX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfobenzoic acid?
The IUPAC name of 3-sulfobenzoic acid (CID 8477) is 3-sulfobenzoic acid.
What is the SMILES notation for 3-sulfobenzoic acid?
The canonical SMILES for 3-sulfobenzoic acid is O=C(O)c1cccc(S(=O)(=O)O)c1.
What is the InChIKey of 3-sulfobenzoic acid?
The InChIKey is QMWGSOMVXSRXQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O5S/c8-7(9)5-2-1-3-6(4-5)13(10,11)12/h1-4H,(H,8,9)(H,10,11,12).
What are the key properties of 3-sulfobenzoic acid?
3-sulfobenzoic acid has a molecular weight of 202.19 g/mol, XLogP of 0.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfobenzoic acid is sourced from PubChem (CID 8477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).