About 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile
2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile (PubChem CID 84770011) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile |
| PubChem CID | 84770011 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile |
| SMILES | N#CCc1ccccc1C1=NCCO1 |
| InChI | InChI=1S/C11H10N2O/c12-6-5-9-3-1-2-4-10(9)11-13-7-8-14-11/h1-4H,5,7-8H2 |
| InChIKey | WUSCBRUALQBOFC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile?
The IUPAC name of 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile (CID 84770011) is 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile.
What is the SMILES notation for 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile?
The canonical SMILES for 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile is N#CCc1ccccc1C1=NCCO1.
What is the InChIKey of 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile?
The InChIKey is WUSCBRUALQBOFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c12-6-5-9-3-1-2-4-10(9)11-13-7-8-14-11/h1-4H,5,7-8H2.
What are the key properties of 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile?
2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile has a molecular weight of 186.21 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]acetonitrile is sourced from PubChem (CID 84770011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).