About 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde
3-chloro-5-fluoro-2,4-dimethylbenzaldehyde (PubChem CID 84770199) has the molecular formula C9H8ClFO
and a molecular weight of 186.61 g/mol. Its IUPAC name is 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde |
| PubChem CID | 84770199 |
| Molecular Formula | C9H8ClFO |
| Molecular Weight | 186.61 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde |
| SMILES | Cc1c(F)cc(C=O)c(C)c1Cl |
| InChI | InChI=1S/C9H8ClFO/c1-5-7(4-12)3-8(11)6(2)9(5)10/h3-4H,1-2H3 |
| InChIKey | SMJAENAQAVEKNW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde?
The IUPAC name of 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde (CID 84770199) is 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde.
What is the SMILES notation for 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde?
The canonical SMILES for 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde is Cc1c(F)cc(C=O)c(C)c1Cl.
What is the InChIKey of 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde?
The InChIKey is SMJAENAQAVEKNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClFO/c1-5-7(4-12)3-8(11)6(2)9(5)10/h3-4H,1-2H3.
What are the key properties of 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde?
3-chloro-5-fluoro-2,4-dimethylbenzaldehyde has a molecular weight of 186.61 g/mol, XLogP of 2.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-fluoro-2,4-dimethylbenzaldehyde is sourced from PubChem (CID 84770199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).