5-amino-1,3-thiazole-2,4-dicarboxylic acid

C5H4N2O4S — CID 84770637

IUPAC5-amino-1,3-thiazole-2,4-dicarboxylic acid
SMILESNc1sc(C(=O)O)nc1C(=O)O
InChIInChI=1S/C5H4N2O4S/c6-2-1(4(8)9)7-3(12-2)5(10)11/h6H2,(H,8,9)(H,10,11)
InChIKeyLKPDLNJPLFZLNU-UHFFFAOYSA-N
MW188.16 g/mol
LogP0.12
Rot. Bonds2

About 5-amino-1,3-thiazole-2,4-dicarboxylic acid

5-amino-1,3-thiazole-2,4-dicarboxylic acid (PubChem CID 84770637) has the molecular formula C5H4N2O4S and a molecular weight of 188.16 g/mol. Its IUPAC name is 5-amino-1,3-thiazole-2,4-dicarboxylic acid.

Molecular Properties

Compound Name5-amino-1,3-thiazole-2,4-dicarboxylic acid
PubChem CID84770637
Molecular FormulaC5H4N2O4S
Molecular Weight188.16 g/mol
Exact Mass187.99
IUPAC Name5-amino-1,3-thiazole-2,4-dicarboxylic acid
SMILESNc1sc(C(=O)O)nc1C(=O)O
InChIInChI=1S/C5H4N2O4S/c6-2-1(4(8)9)7-3(12-2)5(10)11/h6H2,(H,8,9)(H,10,11)
InChIKeyLKPDLNJPLFZLNU-UHFFFAOYSA-N
XLogP0.12
TPSA113.51 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.16
LogP ≤ 50.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 5-amino-1,3-thiazole-2,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-Amino-1,3-thiazole-4-carboxylic acid
CID 23023739
5-Amino-2-methyl-1,3-thiazole-4-carboxylic acid
CID 23023808
5-Amino-2-(trifluoromethyl)-1,3-thiazole-4-carboxylic acid
CID 135371620
5-Amino-2-(2,2,2-trifluoroethyl)-1,3-thiazole-4-carboxylic acid
CID 165792226
5-Amino-2-(2,2-difluoropropyl)-1,3-thiazole-4-carboxylic acid
CID 165893941
5-Amino-2-propan-2-yl-1,3-thiazole-4-carboxylic acid
CID 21093533
2-Boc-amino-4-thiazole carboxylic acid
CID 53249744
5-Amino-2-methylsulfanyl-1,3-thiazole-4-carboxylic acid
CID 67051972
5-Amino-2-ethyl-1,3-thiazole-4-carboxylic acid
CID 67421917
2-Ethyl-5-hydrazinyl-1,3-thiazole-4-carboxylic acid
CID 67423009
2-Methyl-5-(methylamino)-1,3-thiazole-4-carboxylic acid
CID 68405728
5-(Dimethylamino)-2-methyl-1,3-thiazole-4-carboxylic acid
CID 68407228

Frequently Asked Questions

What is the IUPAC name of 5-amino-1,3-thiazole-2,4-dicarboxylic acid?
The IUPAC name of 5-amino-1,3-thiazole-2,4-dicarboxylic acid (CID 84770637) is 5-amino-1,3-thiazole-2,4-dicarboxylic acid.
What is the SMILES notation for 5-amino-1,3-thiazole-2,4-dicarboxylic acid?
The canonical SMILES for 5-amino-1,3-thiazole-2,4-dicarboxylic acid is Nc1sc(C(=O)O)nc1C(=O)O.
What is the InChIKey of 5-amino-1,3-thiazole-2,4-dicarboxylic acid?
The InChIKey is LKPDLNJPLFZLNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O4S/c6-2-1(4(8)9)7-3(12-2)5(10)11/h6H2,(H,8,9)(H,10,11).
What are the key properties of 5-amino-1,3-thiazole-2,4-dicarboxylic acid?
5-amino-1,3-thiazole-2,4-dicarboxylic acid has a molecular weight of 188.16 g/mol, XLogP of 0.12, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,3-thiazole-2,4-dicarboxylic acid is sourced from PubChem (CID 84770637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).