About 3-amino-2,4-difluoro-6-hydroxybenzoic acid
3-amino-2,4-difluoro-6-hydroxybenzoic acid (PubChem CID 84770911) has the molecular formula C7H5F2NO3
and a molecular weight of 189.12 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-6-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 3-amino-2,4-difluoro-6-hydroxybenzoic acid |
| PubChem CID | 84770911 |
| Molecular Formula | C7H5F2NO3 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 3-amino-2,4-difluoro-6-hydroxybenzoic acid |
| SMILES | Nc1c(F)cc(O)c(C(=O)O)c1F |
| InChI | InChI=1S/C7H5F2NO3/c8-2-1-3(11)4(7(12)13)5(9)6(2)10/h1,11H,10H2,(H,12,13) |
| InChIKey | WSVISKRLRGVJJZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,4-difluoro-6-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4-difluoro-6-hydroxybenzoic acid?
The IUPAC name of 3-amino-2,4-difluoro-6-hydroxybenzoic acid (CID 84770911) is 3-amino-2,4-difluoro-6-hydroxybenzoic acid.
What is the SMILES notation for 3-amino-2,4-difluoro-6-hydroxybenzoic acid?
The canonical SMILES for 3-amino-2,4-difluoro-6-hydroxybenzoic acid is Nc1c(F)cc(O)c(C(=O)O)c1F.
What is the InChIKey of 3-amino-2,4-difluoro-6-hydroxybenzoic acid?
The InChIKey is WSVISKRLRGVJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2NO3/c8-2-1-3(11)4(7(12)13)5(9)6(2)10/h1,11H,10H2,(H,12,13).
What are the key properties of 3-amino-2,4-difluoro-6-hydroxybenzoic acid?
3-amino-2,4-difluoro-6-hydroxybenzoic acid has a molecular weight of 189.12 g/mol, XLogP of 0.95, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4-difluoro-6-hydroxybenzoic acid is sourced from PubChem (CID 84770911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).