About 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol
4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol (PubChem CID 84770929) has the molecular formula C8H9F2NO2
and a molecular weight of 189.16 g/mol. Its IUPAC name is 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol.
Molecular Properties
| Compound Name | 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol |
| PubChem CID | 84770929 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol |
| SMILES | NCC(O)c1c(F)cc(O)cc1F |
| InChI | InChI=1S/C8H9F2NO2/c9-5-1-4(12)2-6(10)8(5)7(13)3-11/h1-2,7,12-13H,3,11H2 |
| InChIKey | JVOWGNSCMUZXGT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol?
The IUPAC name of 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol (CID 84770929) is 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol.
What is the SMILES notation for 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol?
The canonical SMILES for 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol is NCC(O)c1c(F)cc(O)cc1F.
What is the InChIKey of 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol?
The InChIKey is JVOWGNSCMUZXGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO2/c9-5-1-4(12)2-6(10)8(5)7(13)3-11/h1-2,7,12-13H,3,11H2.
What are the key properties of 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol?
4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol has a molecular weight of 189.16 g/mol, XLogP of 0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1-hydroxyethyl)-3,5-difluorophenol is sourced from PubChem (CID 84770929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).