2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid

C7H8FNO2S — CID 84771010

IUPAC2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid
SMILESCC(C(=O)O)c1ncc(CF)s1
InChIInChI=1S/C7H8FNO2S/c1-4(7(10)11)6-9-3-5(2-8)12-6/h3-4H,2H2,1H3,(H,10,11)
InChIKeyPJZDPEPVRTZCTQ-UHFFFAOYSA-N
MW189.21 g/mol
LogP1.80
Rot. Bonds3

About 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid

2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid (PubChem CID 84771010) has the molecular formula C7H8FNO2S and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid.

Molecular Properties

Compound Name2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid
PubChem CID84771010
Molecular FormulaC7H8FNO2S
Molecular Weight189.21 g/mol
Exact Mass189.03
IUPAC Name2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid
SMILESCC(C(=O)O)c1ncc(CF)s1
InChIInChI=1S/C7H8FNO2S/c1-4(7(10)11)6-9-3-5(2-8)12-6/h3-4H,2H2,1H3,(H,10,11)
InChIKeyPJZDPEPVRTZCTQ-UHFFFAOYSA-N
XLogP1.80
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.21
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid?
The IUPAC name of 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid (CID 84771010) is 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid.
What is the SMILES notation for 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid?
The canonical SMILES for 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid is CC(C(=O)O)c1ncc(CF)s1.
What is the InChIKey of 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid?
The InChIKey is PJZDPEPVRTZCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO2S/c1-4(7(10)11)6-9-3-5(2-8)12-6/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid?
2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid has a molecular weight of 189.21 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(fluoromethyl)-1,3-thiazol-2-yl]propanoic acid is sourced from PubChem (CID 84771010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).