About 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one
3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one (PubChem CID 84771472) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one |
| PubChem CID | 84771472 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one |
| SMILES | NCCC(=O)c1cnc2ccnn2c1 |
| InChI | InChI=1S/C9H10N4O/c10-3-1-8(14)7-5-11-9-2-4-12-13(9)6-7/h2,4-6H,1,3,10H2 |
| InChIKey | RYCHWQMADHSVGD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one?
The IUPAC name of 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one (CID 84771472) is 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one.
What is the SMILES notation for 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one?
The canonical SMILES for 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one is NCCC(=O)c1cnc2ccnn2c1.
What is the InChIKey of 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one?
The InChIKey is RYCHWQMADHSVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c10-3-1-8(14)7-5-11-9-2-4-12-13(9)6-7/h2,4-6H,1,3,10H2.
What are the key properties of 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one?
3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one has a molecular weight of 190.21 g/mol, XLogP of 0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-pyrazolo[1,5-a]pyrimidin-6-ylpropan-1-one is sourced from PubChem (CID 84771472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).