C10H14N4 — CID 84771579
3-pyrazolo[1,5-a]pyrimidin-6-ylbutan-1-amine (PubChem CID 84771579) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-pyrazolo[1,5-a]pyrimidin-6-ylbutan-1-amine.
| Compound Name | 3-pyrazolo[1,5-a]pyrimidin-6-ylbutan-1-amine |
|---|---|
| PubChem CID | 84771579 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-pyrazolo[1,5-a]pyrimidin-6-ylbutan-1-amine |
| SMILES | CC(CCN)c1cnc2ccnn2c1 |
| InChI | InChI=1S/C10H14N4/c1-8(2-4-11)9-6-12-10-3-5-13-14(10)7-9/h3,5-8H,2,4,11H2,1H3 |
| InChIKey | DVZIGJRBWPKQTA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |