About 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol
4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol (PubChem CID 84771858) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol.
Molecular Properties
| Compound Name | 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol |
| PubChem CID | 84771858 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol |
| SMILES | NC1(c2c(O)ccc3c2COC3)CC1 |
| InChI | InChI=1S/C11H13NO2/c12-11(3-4-11)10-8-6-14-5-7(8)1-2-9(10)13/h1-2,13H,3-6,12H2 |
| InChIKey | GSXYRLKWVUVZPN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol?
The IUPAC name of 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol (CID 84771858) is 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol.
What is the SMILES notation for 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol?
The canonical SMILES for 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol is NC1(c2c(O)ccc3c2COC3)CC1.
What is the InChIKey of 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol?
The InChIKey is GSXYRLKWVUVZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c12-11(3-4-11)10-8-6-14-5-7(8)1-2-9(10)13/h1-2,13H,3-6,12H2.
What are the key properties of 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol?
4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol has a molecular weight of 191.23 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminocyclopropyl)-1,3-dihydro-2-benzofuran-5-ol is sourced from PubChem (CID 84771858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).