2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid

C9H8N2O3 — CID 84772218

IUPAC2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid
SMILESNC(C(=O)O)c1coc2cccnc12
InChIInChI=1S/C9H8N2O3/c10-7(9(12)13)5-4-14-6-2-1-3-11-8(5)6/h1-4,7H,10H2,(H,12,13)
InChIKeyCYPRXMIDDFOBRC-UHFFFAOYSA-N
MW192.17 g/mol
LogP0.91
Rot. Bonds2

About 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid

2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid (PubChem CID 84772218) has the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid.

Molecular Properties

Compound Name2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid
PubChem CID84772218
Molecular FormulaC9H8N2O3
Molecular Weight192.17 g/mol
Exact Mass192.05
IUPAC Name2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid
SMILESNC(C(=O)O)c1coc2cccnc12
InChIInChI=1S/C9H8N2O3/c10-7(9(12)13)5-4-14-6-2-1-3-11-8(5)6/h1-4,7H,10H2,(H,12,13)
InChIKeyCYPRXMIDDFOBRC-UHFFFAOYSA-N
XLogP0.91
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid?
The IUPAC name of 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid (CID 84772218) is 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid.
What is the SMILES notation for 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid?
The canonical SMILES for 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid is NC(C(=O)O)c1coc2cccnc12.
What is the InChIKey of 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid?
The InChIKey is CYPRXMIDDFOBRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3/c10-7(9(12)13)5-4-14-6-2-1-3-11-8(5)6/h1-4,7H,10H2,(H,12,13).
What are the key properties of 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid?
2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid has a molecular weight of 192.17 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-furo[3,2-b]pyridin-3-ylacetic acid is sourced from PubChem (CID 84772218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).